C24H26N8O — CID 117085779
2-N-(1-methylbenzimidazol-2-yl)-6-N-(2-phenoxyethyl)-9-propan-2-ylpurine-2,6-diamine (PubChem CID 117085779) has the molecular formula C24H26N8O and a molecular weight of 442.53 g/mol. Its IUPAC name is 2-N-(1-methylbenzimidazol-2-yl)-6-N-(2-phenoxyethyl)-9-propan-2-ylpurine-2,6-diamine.
| Compound Name | 2-N-(1-methylbenzimidazol-2-yl)-6-N-(2-phenoxyethyl)-9-propan-2-ylpurine-2,6-diamine |
|---|---|
| PubChem CID | 117085779 |
| Molecular Formula | C24H26N8O |
| Molecular Weight | 442.53 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | 2-N-(1-methylbenzimidazol-2-yl)-6-N-(2-phenoxyethyl)-9-propan-2-ylpurine-2,6-diamine |
| SMILES | CC(C)n1cnc2c(NCCOc3ccccc3)nc(Nc3nc4ccccc4n3C)nc21 |
| InChI | InChI=1S/C24H26N8O/c1-16(2)32-15-26-20-21(25-13-14-33-17-9-5-4-6-10-17)28-23(29-22(20)32)30-24-27-18-11-7-8-12-19(18)31(24)3/h4-12,15-16H,13-14H2,1-3H3,(H2,25,27,28,29,30) |
| InChIKey | YKSJGYPRDJEDGP-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 94.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.53 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|