C29H33N9O — CID 117089964
6-N-(1H-benzimidazol-2-ylmethyl)-9-cyclohexyl-2-N-(4-morpholin-4-ylphenyl)purine-2,6-diamine (PubChem CID 117089964) has the molecular formula C29H33N9O and a molecular weight of 523.65 g/mol. Its IUPAC name is 6-N-(1H-benzimidazol-2-ylmethyl)-9-cyclohexyl-2-N-(4-morpholin-4-ylphenyl)purine-2,6-diamine.
| Compound Name | 6-N-(1H-benzimidazol-2-ylmethyl)-9-cyclohexyl-2-N-(4-morpholin-4-ylphenyl)purine-2,6-diamine |
|---|---|
| PubChem CID | 117089964 |
| Molecular Formula | C29H33N9O |
| Molecular Weight | 523.65 g/mol |
| Exact Mass | 523.28 |
| IUPAC Name | 6-N-(1H-benzimidazol-2-ylmethyl)-9-cyclohexyl-2-N-(4-morpholin-4-ylphenyl)purine-2,6-diamine |
| SMILES | c1ccc2[nH]c(CNc3nc(Nc4ccc(N5CCOCC5)cc4)nc4c3ncn4C3CCCCC3)nc2c1 |
| InChI | InChI=1S/C29H33N9O/c1-2-6-22(7-3-1)38-19-31-26-27(30-18-25-33-23-8-4-5-9-24(23)34-25)35-29(36-28(26)38)32-20-10-12-21(13-11-20)37-14-16-39-17-15-37/h4-5,8-13,19,22H,1-3,6-7,14-18H2,(H,33,34)(H2,30,32,35,36) |
| InChIKey | WXLCEQXYVDPKLC-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 108.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.65 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|