C29H34N8O3 — CID 118420836
[3-[6-(benzylamino)-2-(4-morpholin-4-ylanilino)purin-9-yl]cyclohexyl]carbamic acid (PubChem CID 118420836) has the molecular formula C29H34N8O3 and a molecular weight of 542.64 g/mol. Its IUPAC name is [3-[6-(benzylamino)-2-(4-morpholin-4-ylanilino)purin-9-yl]cyclohexyl]carbamic acid.
| Compound Name | [3-[6-(benzylamino)-2-(4-morpholin-4-ylanilino)purin-9-yl]cyclohexyl]carbamic acid |
|---|---|
| PubChem CID | 118420836 |
| Molecular Formula | C29H34N8O3 |
| Molecular Weight | 542.64 g/mol |
| Exact Mass | 542.28 |
| IUPAC Name | [3-[6-(benzylamino)-2-(4-morpholin-4-ylanilino)purin-9-yl]cyclohexyl]carbamic acid |
| SMILES | O=C(O)NC1CCCC(n2cnc3c(NCc4ccccc4)nc(Nc4ccc(N5CCOCC5)cc4)nc32)C1 |
| InChI | InChI=1S/C29H34N8O3/c38-29(39)33-22-7-4-8-24(17-22)37-19-31-25-26(30-18-20-5-2-1-3-6-20)34-28(35-27(25)37)32-21-9-11-23(12-10-21)36-13-15-40-16-14-36/h1-3,5-6,9-12,19,22,24,33H,4,7-8,13-18H2,(H,38,39)(H2,30,32,34,35) |
| InChIKey | RGQFEWMAZDSFEM-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 129.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.64 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|