C32H39N9O2 — CID 123813071
6-N-benzyl-2-N-[4-(2-morpholin-4-ylethoxy)phenyl]-9-(1-prop-2-enimidoylpiperidin-3-yl)purine-2,6-diamine (PubChem CID 123813071) has the molecular formula C32H39N9O2 and a molecular weight of 581.73 g/mol. Its IUPAC name is 6-N-benzyl-2-N-[4-(2-morpholin-4-ylethoxy)phenyl]-9-(1-prop-2-enimidoylpiperidin-3-yl)purine-2,6-diamine.
| Compound Name | 6-N-benzyl-2-N-[4-(2-morpholin-4-ylethoxy)phenyl]-9-(1-prop-2-enimidoylpiperidin-3-yl)purine-2,6-diamine |
|---|---|
| PubChem CID | 123813071 |
| Molecular Formula | C32H39N9O2 |
| Molecular Weight | 581.73 g/mol |
| Exact Mass | 581.32 |
| IUPAC Name | 6-N-benzyl-2-N-[4-(2-morpholin-4-ylethoxy)phenyl]-9-(1-prop-2-enimidoylpiperidin-3-yl)purine-2,6-diamine |
| SMILES | [H]/N=C(\C=C)N1CCCC(n2cnc3c(NCc4ccccc4)nc(Nc4ccc(OCCN5CCOCC5)cc4)nc32)C1 |
| InChI | InChI=1S/C32H39N9O2/c1-2-28(33)40-14-6-9-26(22-40)41-23-35-29-30(34-21-24-7-4-3-5-8-24)37-32(38-31(29)41)36-25-10-12-27(13-11-25)43-20-17-39-15-18-42-19-16-39/h2-5,7-8,10-13,23,26,33H,1,6,9,14-22H2,(H2,34,36,37,38)/b33-28+ |
| InChIKey | RTIIBZUOSJZGGR-PJJLUWSFSA-N |
| XLogP | 4.69 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.73 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|