C31H39N7O4 — CID 118420742
tert-butyl 3-[6-(benzylamino)-2-[3-(2-methoxyethoxy)anilino]purin-9-yl]piperidine-1-carboxylate (PubChem CID 118420742) has the molecular formula C31H39N7O4 and a molecular weight of 573.70 g/mol. Its IUPAC name is tert-butyl 3-[6-(benzylamino)-2-[3-(2-methoxyethoxy)anilino]purin-9-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[6-(benzylamino)-2-[3-(2-methoxyethoxy)anilino]purin-9-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 118420742 |
| Molecular Formula | C31H39N7O4 |
| Molecular Weight | 573.70 g/mol |
| Exact Mass | 573.31 |
| IUPAC Name | tert-butyl 3-[6-(benzylamino)-2-[3-(2-methoxyethoxy)anilino]purin-9-yl]piperidine-1-carboxylate |
| SMILES | COCCOc1cccc(Nc2nc(NCc3ccccc3)c3ncn(C4CCCN(C(=O)OC(C)(C)C)C4)c3n2)c1 |
| InChI | InChI=1S/C31H39N7O4/c1-31(2,3)42-30(39)37-15-9-13-24(20-37)38-21-33-26-27(32-19-22-10-6-5-7-11-22)35-29(36-28(26)38)34-23-12-8-14-25(18-23)41-17-16-40-4/h5-8,10-12,14,18,21,24H,9,13,15-17,19-20H2,1-4H3,(H2,32,34,35,36) |
| InChIKey | SWKWNVIZUZXLIP-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 115.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.70 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|