C16H22ClN5O2 — CID 144937286
tert-butyl 3-(6-chloro-2-methylpurin-9-yl)piperidine-1-carboxylate (PubChem CID 144937286) has the molecular formula C16H22ClN5O2 and a molecular weight of 351.84 g/mol. Its IUPAC name is tert-butyl 3-(6-chloro-2-methylpurin-9-yl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-(6-chloro-2-methylpurin-9-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 144937286 |
| Molecular Formula | C16H22ClN5O2 |
| Molecular Weight | 351.84 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | tert-butyl 3-(6-chloro-2-methylpurin-9-yl)piperidine-1-carboxylate |
| SMILES | Cc1nc(Cl)c2ncn(C3CCCN(C(=O)OC(C)(C)C)C3)c2n1 |
| InChI | InChI=1S/C16H22ClN5O2/c1-10-19-13(17)12-14(20-10)22(9-18-12)11-6-5-7-21(8-11)15(23)24-16(2,3)4/h9,11H,5-8H2,1-4H3 |
| InChIKey | PEVUYIJRVLLTFN-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.84 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |