C16H21Cl2N5O2 — CID 58285323
tert-butyl 4-[(2,6-dichloropurin-9-yl)methyl]piperidine-1-carboxylate (PubChem CID 58285323) has the molecular formula C16H21Cl2N5O2 and a molecular weight of 386.28 g/mol. Its IUPAC name is tert-butyl 4-[(2,6-dichloropurin-9-yl)methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(2,6-dichloropurin-9-yl)methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 58285323 |
| Molecular Formula | C16H21Cl2N5O2 |
| Molecular Weight | 386.28 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | tert-butyl 4-[(2,6-dichloropurin-9-yl)methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Cn2cnc3c(Cl)nc(Cl)nc32)CC1 |
| InChI | InChI=1S/C16H21Cl2N5O2/c1-16(2,3)25-15(24)22-6-4-10(5-7-22)8-23-9-19-11-12(17)20-14(18)21-13(11)23/h9-10H,4-8H2,1-3H3 |
| InChIKey | NHFZFYJLFUSGNR-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.28 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |