C19H27N3O2 — CID 143452162
tert-butyl 4-[(6-aminoindol-1-yl)methyl]piperidine-1-carboxylate (PubChem CID 143452162) has the molecular formula C19H27N3O2 and a molecular weight of 329.44 g/mol. Its IUPAC name is tert-butyl 4-[(6-aminoindol-1-yl)methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(6-aminoindol-1-yl)methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 143452162 |
| Molecular Formula | C19H27N3O2 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | tert-butyl 4-[(6-aminoindol-1-yl)methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Cn2ccc3ccc(N)cc32)CC1 |
| InChI | InChI=1S/C19H27N3O2/c1-19(2,3)24-18(23)21-9-6-14(7-10-21)13-22-11-8-15-4-5-16(20)12-17(15)22/h4-5,8,11-12,14H,6-7,9-10,13,20H2,1-3H3 |
| InChIKey | JHJYUDYNIYAVGB-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 60.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|