C24H27N7O — CID 130246608
2-[6-(3H-indol-2-ylmethylamino)-2-pyrrolidin-1-ylpurin-9-yl]cyclohexan-1-one (PubChem CID 130246608) has the molecular formula C24H27N7O and a molecular weight of 429.53 g/mol. Its IUPAC name is 2-[6-(3H-indol-2-ylmethylamino)-2-pyrrolidin-1-ylpurin-9-yl]cyclohexan-1-one.
| Compound Name | 2-[6-(3H-indol-2-ylmethylamino)-2-pyrrolidin-1-ylpurin-9-yl]cyclohexan-1-one |
|---|---|
| PubChem CID | 130246608 |
| Molecular Formula | C24H27N7O |
| Molecular Weight | 429.53 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | 2-[6-(3H-indol-2-ylmethylamino)-2-pyrrolidin-1-ylpurin-9-yl]cyclohexan-1-one |
| SMILES | O=C1CCCCC1n1cnc2c(NCC3=Nc4ccccc4C3)nc(N3CCCC3)nc21 |
| InChI | InChI=1S/C24H27N7O/c32-20-10-4-3-9-19(20)31-15-26-21-22(28-24(29-23(21)31)30-11-5-6-12-30)25-14-17-13-16-7-1-2-8-18(16)27-17/h1-2,7-8,15,19H,3-6,9-14H2,(H,25,28,29) |
| InChIKey | BKGBCZYVMOBXGL-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 88.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.53 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |