C22H19N7OS — CID 117093044
6-N-(2-phenoxyethyl)-2-N-pyridin-2-yl-9-thiophen-3-ylpurine-2,6-diamine (PubChem CID 117093044) has the molecular formula C22H19N7OS and a molecular weight of 429.51 g/mol. Its IUPAC name is 6-N-(2-phenoxyethyl)-2-N-pyridin-2-yl-9-thiophen-3-ylpurine-2,6-diamine.
| Compound Name | 6-N-(2-phenoxyethyl)-2-N-pyridin-2-yl-9-thiophen-3-ylpurine-2,6-diamine |
|---|---|
| PubChem CID | 117093044 |
| Molecular Formula | C22H19N7OS |
| Molecular Weight | 429.51 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | 6-N-(2-phenoxyethyl)-2-N-pyridin-2-yl-9-thiophen-3-ylpurine-2,6-diamine |
| SMILES | c1ccc(OCCNc2nc(Nc3ccccn3)nc3c2ncn3-c2ccsc2)cc1 |
| InChI | InChI=1S/C22H19N7OS/c1-2-6-17(7-3-1)30-12-11-24-20-19-21(29(15-25-19)16-9-13-31-14-16)28-22(27-20)26-18-8-4-5-10-23-18/h1-10,13-15H,11-12H2,(H2,23,24,26,27,28) |
| InChIKey | UCHRJAYJMAEUDI-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 89.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.51 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|