C22H18N8OS — CID 117090451
N-[4-[[2-(pyridin-4-ylamino)-9-thiophen-3-ylpurin-6-yl]amino]phenyl]acetamide (PubChem CID 117090451) has the molecular formula C22H18N8OS and a molecular weight of 442.51 g/mol. Its IUPAC name is N-[4-[[2-(pyridin-4-ylamino)-9-thiophen-3-ylpurin-6-yl]amino]phenyl]acetamide.
| Compound Name | N-[4-[[2-(pyridin-4-ylamino)-9-thiophen-3-ylpurin-6-yl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 117090451 |
| Molecular Formula | C22H18N8OS |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | N-[4-[[2-(pyridin-4-ylamino)-9-thiophen-3-ylpurin-6-yl]amino]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(Nc2nc(Nc3ccncc3)nc3c2ncn3-c2ccsc2)cc1 |
| InChI | InChI=1S/C22H18N8OS/c1-14(31)25-15-2-4-16(5-3-15)26-20-19-21(30(13-24-19)18-8-11-32-12-18)29-22(28-20)27-17-6-9-23-10-7-17/h2-13H,1H3,(H,25,31)(H2,23,26,27,28,29) |
| InChIKey | JJQWUCFUZVAJMC-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 109.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |