C18H17ClN6OS — CID 25024956
1-[[6-(3-chloroanilino)-9-thiophen-3-ylpurin-2-yl]amino]propan-2-ol (PubChem CID 25024956) has the molecular formula C18H17ClN6OS and a molecular weight of 400.90 g/mol. Its IUPAC name is 1-[[6-(3-chloroanilino)-9-thiophen-3-ylpurin-2-yl]amino]propan-2-ol.
| Compound Name | 1-[[6-(3-chloroanilino)-9-thiophen-3-ylpurin-2-yl]amino]propan-2-ol |
|---|---|
| PubChem CID | 25024956 |
| Molecular Formula | C18H17ClN6OS |
| Molecular Weight | 400.90 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | 1-[[6-(3-chloroanilino)-9-thiophen-3-ylpurin-2-yl]amino]propan-2-ol |
| SMILES | CC(O)CNc1nc(Nc2cccc(Cl)c2)c2ncn(-c3ccsc3)c2n1 |
| InChI | InChI=1S/C18H17ClN6OS/c1-11(26)8-20-18-23-16(22-13-4-2-3-12(19)7-13)15-17(24-18)25(10-21-15)14-5-6-27-9-14/h2-7,9-11,26H,8H2,1H3,(H2,20,22,23,24) |
| InChIKey | ZOJDZOWUGNUOMF-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 87.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.90 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |