C14H15ClN6 — CID 141182611
6-N-(3-chlorophenyl)-9-propan-2-ylpurine-2,6-diamine (PubChem CID 141182611) has the molecular formula C14H15ClN6 and a molecular weight of 302.77 g/mol. Its IUPAC name is 6-N-(3-chlorophenyl)-9-propan-2-ylpurine-2,6-diamine.
| Compound Name | 6-N-(3-chlorophenyl)-9-propan-2-ylpurine-2,6-diamine |
|---|---|
| PubChem CID | 141182611 |
| Molecular Formula | C14H15ClN6 |
| Molecular Weight | 302.77 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 6-N-(3-chlorophenyl)-9-propan-2-ylpurine-2,6-diamine |
| SMILES | CC(C)n1cnc2c(Nc3cccc(Cl)c3)nc(N)nc21 |
| InChI | InChI=1S/C14H15ClN6/c1-8(2)21-7-17-11-12(19-14(16)20-13(11)21)18-10-5-3-4-9(15)6-10/h3-8H,1-2H3,(H3,16,18,19,20) |
| InChIKey | QNRRGEYWWWOXGE-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.77 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |