C13H16N8O — CID 142317527
6-amino-4-[(2-amino-9-propan-2-ylpurin-6-yl)amino]-1H-pyridin-2-one (PubChem CID 142317527) has the molecular formula C13H16N8O and a molecular weight of 300.33 g/mol. Its IUPAC name is 6-amino-4-[(2-amino-9-propan-2-ylpurin-6-yl)amino]-1H-pyridin-2-one.
| Compound Name | 6-amino-4-[(2-amino-9-propan-2-ylpurin-6-yl)amino]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 142317527 |
| Molecular Formula | C13H16N8O |
| Molecular Weight | 300.33 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 6-amino-4-[(2-amino-9-propan-2-ylpurin-6-yl)amino]-1H-pyridin-2-one |
| SMILES | CC(C)n1cnc2c(Nc3cc(N)[nH]c(=O)c3)nc(N)nc21 |
| InChI | InChI=1S/C13H16N8O/c1-6(2)21-5-16-10-11(19-13(15)20-12(10)21)17-7-3-8(14)18-9(22)4-7/h3-6H,1-2H3,(H6,14,15,17,18,19,20,22) |
| InChIKey | HYDLTBWPPRBACU-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 140.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.33 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |