C20H26ClN7 — CID 158749481
5-chloro-3-N-[2-[[(3S)-piperidin-3-yl]methyl]-9-propan-2-ylpurin-6-yl]benzene-1,3-diamine (PubChem CID 158749481) has the molecular formula C20H26ClN7 and a molecular weight of 399.93 g/mol. Its IUPAC name is 5-chloro-3-N-[2-[[(3S)-piperidin-3-yl]methyl]-9-propan-2-ylpurin-6-yl]benzene-1,3-diamine.
| Compound Name | 5-chloro-3-N-[2-[[(3S)-piperidin-3-yl]methyl]-9-propan-2-ylpurin-6-yl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 158749481 |
| Molecular Formula | C20H26ClN7 |
| Molecular Weight | 399.93 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | 5-chloro-3-N-[2-[[(3S)-piperidin-3-yl]methyl]-9-propan-2-ylpurin-6-yl]benzene-1,3-diamine |
| SMILES | CC(C)n1cnc2c(Nc3cc(N)cc(Cl)c3)nc(C[C@@H]3CCCNC3)nc21 |
| InChI | InChI=1S/C20H26ClN7/c1-12(2)28-11-24-18-19(25-16-8-14(21)7-15(22)9-16)26-17(27-20(18)28)6-13-4-3-5-23-10-13/h7-9,11-13,23H,3-6,10,22H2,1-2H3,(H,25,26,27)/t13-/m0/s1 |
| InChIKey | INHHMRUNWUJLAL-ZDUSSCGKSA-N |
| XLogP | 3.93 |
| TPSA | 93.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.93 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|