C13H21N3 — CID 105474903
4,5,6-trimethyl-2-(piperidin-3-ylmethyl)pyrimidine (PubChem CID 105474903) has the molecular formula C13H21N3 and a molecular weight of 219.33 g/mol. Its IUPAC name is 4,5,6-trimethyl-2-(piperidin-3-ylmethyl)pyrimidine.
| Compound Name | 4,5,6-trimethyl-2-(piperidin-3-ylmethyl)pyrimidine |
|---|---|
| PubChem CID | 105474903 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | 4,5,6-trimethyl-2-(piperidin-3-ylmethyl)pyrimidine |
| SMILES | Cc1nc(CC2CCCNC2)nc(C)c1C |
| InChI | InChI=1S/C13H21N3/c1-9-10(2)15-13(16-11(9)3)7-12-5-4-6-14-8-12/h12,14H,4-8H2,1-3H3 |
| InChIKey | URYJPSLDYHLAPS-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |