C23H33N7 — CID 167654262
N-[3-(aminomethyl)phenyl]-2-[[4-(methylamino)cyclohexyl]methyl]-9-propan-2-ylpurin-6-amine (PubChem CID 167654262) has the molecular formula C23H33N7 and a molecular weight of 407.57 g/mol. Its IUPAC name is N-[3-(aminomethyl)phenyl]-2-[[4-(methylamino)cyclohexyl]methyl]-9-propan-2-ylpurin-6-amine.
| Compound Name | N-[3-(aminomethyl)phenyl]-2-[[4-(methylamino)cyclohexyl]methyl]-9-propan-2-ylpurin-6-amine |
|---|---|
| PubChem CID | 167654262 |
| Molecular Formula | C23H33N7 |
| Molecular Weight | 407.57 g/mol |
| Exact Mass | 407.28 |
| IUPAC Name | N-[3-(aminomethyl)phenyl]-2-[[4-(methylamino)cyclohexyl]methyl]-9-propan-2-ylpurin-6-amine |
| SMILES | CNC1CCC(Cc2nc(Nc3cccc(CN)c3)c3ncn(C(C)C)c3n2)CC1 |
| InChI | InChI=1S/C23H33N7/c1-15(2)30-14-26-21-22(27-19-6-4-5-17(11-19)13-24)28-20(29-23(21)30)12-16-7-9-18(25-3)10-8-16/h4-6,11,14-16,18,25H,7-10,12-13,24H2,1-3H3,(H,27,28,29) |
| InChIKey | LMKCKAPLZKLFOC-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 93.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.57 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |