C14H23N7O2 — CID 127027440
6-[(2-amino-9-propan-2-ylpurin-6-yl)amino]-N-hydroxyhexanamide (PubChem CID 127027440) has the molecular formula C14H23N7O2 and a molecular weight of 321.39 g/mol. Its IUPAC name is 6-[(2-amino-9-propan-2-ylpurin-6-yl)amino]-N-hydroxyhexanamide.
| Compound Name | 6-[(2-amino-9-propan-2-ylpurin-6-yl)amino]-N-hydroxyhexanamide |
|---|---|
| PubChem CID | 127027440 |
| Molecular Formula | C14H23N7O2 |
| Molecular Weight | 321.39 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | 6-[(2-amino-9-propan-2-ylpurin-6-yl)amino]-N-hydroxyhexanamide |
| SMILES | CC(C)n1cnc2c(NCCCCCC(=O)NO)nc(N)nc21 |
| InChI | InChI=1S/C14H23N7O2/c1-9(2)21-8-17-11-12(18-14(15)19-13(11)21)16-7-5-3-4-6-10(22)20-23/h8-9,23H,3-7H2,1-2H3,(H,20,22)(H3,15,16,18,19) |
| InChIKey | DQXQMCUQEPLNCB-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 130.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.39 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|