C16H20N6O — CID 117080503
2-[[2-(3-aminophenyl)-9-propan-2-ylpurin-6-yl]amino]ethanol (PubChem CID 117080503) has the molecular formula C16H20N6O and a molecular weight of 312.38 g/mol. Its IUPAC name is 2-[[2-(3-aminophenyl)-9-propan-2-ylpurin-6-yl]amino]ethanol.
| Compound Name | 2-[[2-(3-aminophenyl)-9-propan-2-ylpurin-6-yl]amino]ethanol |
|---|---|
| PubChem CID | 117080503 |
| Molecular Formula | C16H20N6O |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 2-[[2-(3-aminophenyl)-9-propan-2-ylpurin-6-yl]amino]ethanol |
| SMILES | CC(C)n1cnc2c(NCCO)nc(-c3cccc(N)c3)nc21 |
| InChI | InChI=1S/C16H20N6O/c1-10(2)22-9-19-13-15(18-6-7-23)20-14(21-16(13)22)11-4-3-5-12(17)8-11/h3-5,8-10,23H,6-7,17H2,1-2H3,(H,18,20,21) |
| InChIKey | WNTNHCSOTGPKOL-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 101.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|