C22H24N8O2 — CID 46891169
1-(3-aminophenyl)-3-[3-[6-(3-hydroxypropylamino)-9-methylpurin-2-yl]phenyl]urea (PubChem CID 46891169) has the molecular formula C22H24N8O2 and a molecular weight of 432.49 g/mol. Its IUPAC name is 1-(3-aminophenyl)-3-[3-[6-(3-hydroxypropylamino)-9-methylpurin-2-yl]phenyl]urea.
| Compound Name | 1-(3-aminophenyl)-3-[3-[6-(3-hydroxypropylamino)-9-methylpurin-2-yl]phenyl]urea |
|---|---|
| PubChem CID | 46891169 |
| Molecular Formula | C22H24N8O2 |
| Molecular Weight | 432.49 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | 1-(3-aminophenyl)-3-[3-[6-(3-hydroxypropylamino)-9-methylpurin-2-yl]phenyl]urea |
| SMILES | Cn1cnc2c(NCCCO)nc(-c3cccc(NC(=O)Nc4cccc(N)c4)c3)nc21 |
| InChI | InChI=1S/C22H24N8O2/c1-30-13-25-18-20(24-9-4-10-31)28-19(29-21(18)30)14-5-2-7-16(11-14)26-22(32)27-17-8-3-6-15(23)12-17/h2-3,5-8,11-13,31H,4,9-10,23H2,1H3,(H,24,28,29)(H2,26,27,32) |
| InChIKey | FXWBDVIANIGTLF-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 143.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.49 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|