C23H24ClN7O2 — CID 46891310
1-(3-chlorophenyl)-3-[3-[6-[3-hydroxypropyl(methyl)amino]-9-methylpurin-2-yl]phenyl]urea (PubChem CID 46891310) has the molecular formula C23H24ClN7O2 and a molecular weight of 465.95 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[3-[6-[3-hydroxypropyl(methyl)amino]-9-methylpurin-2-yl]phenyl]urea.
| Compound Name | 1-(3-chlorophenyl)-3-[3-[6-[3-hydroxypropyl(methyl)amino]-9-methylpurin-2-yl]phenyl]urea |
|---|---|
| PubChem CID | 46891310 |
| Molecular Formula | C23H24ClN7O2 |
| Molecular Weight | 465.95 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[3-[6-[3-hydroxypropyl(methyl)amino]-9-methylpurin-2-yl]phenyl]urea |
| SMILES | CN(CCCO)c1nc(-c2cccc(NC(=O)Nc3cccc(Cl)c3)c2)nc2c1ncn2C |
| InChI | InChI=1S/C23H24ClN7O2/c1-30(10-5-11-32)21-19-22(31(2)14-25-19)29-20(28-21)15-6-3-8-17(12-15)26-23(33)27-18-9-4-7-16(24)13-18/h3-4,6-9,12-14,32H,5,10-11H2,1-2H3,(H2,26,27,33) |
| InChIKey | UBPUPMDADODRPJ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 108.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.95 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |