C25H19ClN6O — CID 46238208
1-(2-benzyl-6-phenylpyrazolo[3,4-d]pyrimidin-4-yl)-3-(3-chlorophenyl)urea (PubChem CID 46238208) has the molecular formula C25H19ClN6O and a molecular weight of 454.92 g/mol. Its IUPAC name is 1-(2-benzyl-6-phenylpyrazolo[3,4-d]pyrimidin-4-yl)-3-(3-chlorophenyl)urea.
| Compound Name | 1-(2-benzyl-6-phenylpyrazolo[3,4-d]pyrimidin-4-yl)-3-(3-chlorophenyl)urea |
|---|---|
| PubChem CID | 46238208 |
| Molecular Formula | C25H19ClN6O |
| Molecular Weight | 454.92 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | 1-(2-benzyl-6-phenylpyrazolo[3,4-d]pyrimidin-4-yl)-3-(3-chlorophenyl)urea |
| SMILES | O=C(Nc1cccc(Cl)c1)Nc1nc(-c2ccccc2)nc2nn(Cc3ccccc3)cc12 |
| InChI | InChI=1S/C25H19ClN6O/c26-19-12-7-13-20(14-19)27-25(33)30-23-21-16-32(15-17-8-3-1-4-9-17)31-24(21)29-22(28-23)18-10-5-2-6-11-18/h1-14,16H,15H2,(H2,27,28,29,30,31,33) |
| InChIKey | OUSVGIIJFWDOKZ-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.92 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |