C25H23N5O2 — CID 99181106
1-benzyl-N-[3-(methylcarbamoylamino)phenyl]-3-phenylpyrazole-4-carboxamide (PubChem CID 99181106) has the molecular formula C25H23N5O2 and a molecular weight of 425.49 g/mol. Its IUPAC name is 1-benzyl-N-[3-(methylcarbamoylamino)phenyl]-3-phenylpyrazole-4-carboxamide.
| Compound Name | 1-benzyl-N-[3-(methylcarbamoylamino)phenyl]-3-phenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 99181106 |
| Molecular Formula | C25H23N5O2 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | 1-benzyl-N-[3-(methylcarbamoylamino)phenyl]-3-phenylpyrazole-4-carboxamide |
| SMILES | CNC(=O)Nc1cccc(NC(=O)c2cn(Cc3ccccc3)nc2-c2ccccc2)c1 |
| InChI | InChI=1S/C25H23N5O2/c1-26-25(32)28-21-14-8-13-20(15-21)27-24(31)22-17-30(16-18-9-4-2-5-10-18)29-23(22)19-11-6-3-7-12-19/h2-15,17H,16H2,1H3,(H,27,31)(H2,26,28,32) |
| InChIKey | YLZQILGCFXHYRQ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 88.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |