C24H21ClN4O — CID 43021494
1-benzyl-N'-(3-chlorophenyl)-3-(4-methylphenyl)pyrazole-4-carbohydrazide (PubChem CID 43021494) has the molecular formula C24H21ClN4O and a molecular weight of 416.91 g/mol. Its IUPAC name is 1-benzyl-N'-(3-chlorophenyl)-3-(4-methylphenyl)pyrazole-4-carbohydrazide.
| Compound Name | 1-benzyl-N'-(3-chlorophenyl)-3-(4-methylphenyl)pyrazole-4-carbohydrazide |
|---|---|
| PubChem CID | 43021494 |
| Molecular Formula | C24H21ClN4O |
| Molecular Weight | 416.91 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | 1-benzyl-N'-(3-chlorophenyl)-3-(4-methylphenyl)pyrazole-4-carbohydrazide |
| SMILES | Cc1ccc(-c2nn(Cc3ccccc3)cc2C(=O)NNc2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C24H21ClN4O/c1-17-10-12-19(13-11-17)23-22(16-29(28-23)15-18-6-3-2-4-7-18)24(30)27-26-21-9-5-8-20(25)14-21/h2-14,16,26H,15H2,1H3,(H,27,30) |
| InChIKey | NMHSNVVQNIURIV-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.91 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|