C27H23N5O3 — CID 55617368
1-benzyl-N-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]-3-phenylpyrazole-4-carboxamide (PubChem CID 55617368) has the molecular formula C27H23N5O3 and a molecular weight of 465.51 g/mol. Its IUPAC name is 1-benzyl-N-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]-3-phenylpyrazole-4-carboxamide.
| Compound Name | 1-benzyl-N-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]-3-phenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 55617368 |
| Molecular Formula | C27H23N5O3 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | 1-benzyl-N-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]-3-phenylpyrazole-4-carboxamide |
| SMILES | O=C(Nc1cccc(CN2C(=O)CNC2=O)c1)c1cn(Cc2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C27H23N5O3/c33-24-15-28-27(35)32(24)17-20-10-7-13-22(14-20)29-26(34)23-18-31(16-19-8-3-1-4-9-19)30-25(23)21-11-5-2-6-12-21/h1-14,18H,15-17H2,(H,28,35)(H,29,34) |
| InChIKey | RZHXPMUNKRATTA-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|