C28H25N5O4 — CID 55961871
1-benzyl-3-(4-methoxyphenyl)-N-[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]pyrazole-4-carboxamide (PubChem CID 55961871) has the molecular formula C28H25N5O4 and a molecular weight of 495.54 g/mol. Its IUPAC name is 1-benzyl-3-(4-methoxyphenyl)-N-[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]pyrazole-4-carboxamide.
| Compound Name | 1-benzyl-3-(4-methoxyphenyl)-N-[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 55961871 |
| Molecular Formula | C28H25N5O4 |
| Molecular Weight | 495.54 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | 1-benzyl-3-(4-methoxyphenyl)-N-[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]pyrazole-4-carboxamide |
| SMILES | COc1ccc(-c2nn(Cc3ccccc3)cc2C(=O)Nc2cccc(C3(C)NC(=O)NC3=O)c2)cc1 |
| InChI | InChI=1S/C28H25N5O4/c1-28(26(35)30-27(36)31-28)20-9-6-10-21(15-20)29-25(34)23-17-33(16-18-7-4-3-5-8-18)32-24(23)19-11-13-22(37-2)14-12-19/h3-15,17H,16H2,1-2H3,(H,29,34)(H2,30,31,35,36) |
| InChIKey | YILVXFODOBKSRI-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 114.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.54 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|