C19H18ClN3O3S — CID 55617218
2-[(4-chlorophenyl)methylsulfanyl]-N-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]acetamide (PubChem CID 55617218) has the molecular formula C19H18ClN3O3S and a molecular weight of 403.89 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methylsulfanyl]-N-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]acetamide.
| Compound Name | 2-[(4-chlorophenyl)methylsulfanyl]-N-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 55617218 |
| Molecular Formula | C19H18ClN3O3S |
| Molecular Weight | 403.89 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | 2-[(4-chlorophenyl)methylsulfanyl]-N-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]acetamide |
| SMILES | O=C(CSCc1ccc(Cl)cc1)Nc1cccc(CN2C(=O)CNC2=O)c1 |
| InChI | InChI=1S/C19H18ClN3O3S/c20-15-6-4-13(5-7-15)11-27-12-17(24)22-16-3-1-2-14(8-16)10-23-18(25)9-21-19(23)26/h1-8H,9-12H2,(H,21,26)(H,22,24) |
| InChIKey | ZGYMHAAIYDZOAY-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.89 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|