C17H12ClF3N4O — CID 84565072
1-(3-chlorophenyl)-3-[4-phenyl-5-(trifluoromethyl)-1H-pyrazol-3-yl]urea (PubChem CID 84565072) has the molecular formula C17H12ClF3N4O and a molecular weight of 380.76 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[4-phenyl-5-(trifluoromethyl)-1H-pyrazol-3-yl]urea.
| Compound Name | 1-(3-chlorophenyl)-3-[4-phenyl-5-(trifluoromethyl)-1H-pyrazol-3-yl]urea |
|---|---|
| PubChem CID | 84565072 |
| Molecular Formula | C17H12ClF3N4O |
| Molecular Weight | 380.76 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[4-phenyl-5-(trifluoromethyl)-1H-pyrazol-3-yl]urea |
| SMILES | O=C(Nc1cccc(Cl)c1)Nc1n[nH]c(C(F)(F)F)c1-c1ccccc1 |
| InChI | InChI=1S/C17H12ClF3N4O/c18-11-7-4-8-12(9-11)22-16(26)23-15-13(10-5-2-1-3-6-10)14(24-25-15)17(19,20)21/h1-9H,(H3,22,23,24,25,26) |
| InChIKey | XIPVPVQWBGCAMY-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.76 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |