C17H11Cl2F3N4O — CID 21105015
1-(3-chlorophenyl)-3-[1-(4-chlorophenyl)-5-(trifluoromethyl)pyrazol-4-yl]urea (PubChem CID 21105015) has the molecular formula C17H11Cl2F3N4O and a molecular weight of 415.20 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[1-(4-chlorophenyl)-5-(trifluoromethyl)pyrazol-4-yl]urea.
| Compound Name | 1-(3-chlorophenyl)-3-[1-(4-chlorophenyl)-5-(trifluoromethyl)pyrazol-4-yl]urea |
|---|---|
| PubChem CID | 21105015 |
| Molecular Formula | C17H11Cl2F3N4O |
| Molecular Weight | 415.20 g/mol |
| Exact Mass | 414.03 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[1-(4-chlorophenyl)-5-(trifluoromethyl)pyrazol-4-yl]urea |
| SMILES | O=C(Nc1cccc(Cl)c1)Nc1cnn(-c2ccc(Cl)cc2)c1C(F)(F)F |
| InChI | InChI=1S/C17H11Cl2F3N4O/c18-10-4-6-13(7-5-10)26-15(17(20,21)22)14(9-23-26)25-16(27)24-12-3-1-2-11(19)8-12/h1-9H,(H2,24,25,27) |
| InChIKey | BZPXPZCLSYFKFO-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.20 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |