C16H17ClF3N5O — CID 91507780
N-[1-(4-chlorophenyl)-5-(trifluoromethyl)pyrazol-4-yl]-4-methylpiperazine-1-carboxamide (PubChem CID 91507780) has the molecular formula C16H17ClF3N5O and a molecular weight of 387.79 g/mol. Its IUPAC name is N-[1-(4-chlorophenyl)-5-(trifluoromethyl)pyrazol-4-yl]-4-methylpiperazine-1-carboxamide.
| Compound Name | N-[1-(4-chlorophenyl)-5-(trifluoromethyl)pyrazol-4-yl]-4-methylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 91507780 |
| Molecular Formula | C16H17ClF3N5O |
| Molecular Weight | 387.79 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | N-[1-(4-chlorophenyl)-5-(trifluoromethyl)pyrazol-4-yl]-4-methylpiperazine-1-carboxamide |
| SMILES | CN1CCN(C(=O)Nc2cnn(-c3ccc(Cl)cc3)c2C(F)(F)F)CC1 |
| InChI | InChI=1S/C16H17ClF3N5O/c1-23-6-8-24(9-7-23)15(26)22-13-10-21-25(14(13)16(18,19)20)12-4-2-11(17)3-5-12/h2-5,10H,6-9H2,1H3,(H,22,26) |
| InChIKey | KZBNDCJZEPSCBU-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.79 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |