C13H12ClF3N2O — CID 82527513
2-[1-(4-chlorophenyl)-5-(trifluoromethyl)pyrazol-4-yl]propan-2-ol (PubChem CID 82527513) has the molecular formula C13H12ClF3N2O and a molecular weight of 304.70 g/mol. Its IUPAC name is 2-[1-(4-chlorophenyl)-5-(trifluoromethyl)pyrazol-4-yl]propan-2-ol.
| Compound Name | 2-[1-(4-chlorophenyl)-5-(trifluoromethyl)pyrazol-4-yl]propan-2-ol |
|---|---|
| PubChem CID | 82527513 |
| Molecular Formula | C13H12ClF3N2O |
| Molecular Weight | 304.70 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 2-[1-(4-chlorophenyl)-5-(trifluoromethyl)pyrazol-4-yl]propan-2-ol |
| SMILES | CC(C)(O)c1cnn(-c2ccc(Cl)cc2)c1C(F)(F)F |
| InChI | InChI=1S/C13H12ClF3N2O/c1-12(2,20)10-7-18-19(11(10)13(15,16)17)9-5-3-8(14)4-6-9/h3-7,20H,1-2H3 |
| InChIKey | UJOCZYRLXGYIJY-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.70 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |