C18H19ClF3N3O — CID 11474632
1-(4-chlorophenyl)-N-cyclohexyl-N-methyl-5-(trifluoromethyl)pyrazole-4-carboxamide (PubChem CID 11474632) has the molecular formula C18H19ClF3N3O and a molecular weight of 385.82 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-cyclohexyl-N-methyl-5-(trifluoromethyl)pyrazole-4-carboxamide.
| Compound Name | 1-(4-chlorophenyl)-N-cyclohexyl-N-methyl-5-(trifluoromethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 11474632 |
| Molecular Formula | C18H19ClF3N3O |
| Molecular Weight | 385.82 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | 1-(4-chlorophenyl)-N-cyclohexyl-N-methyl-5-(trifluoromethyl)pyrazole-4-carboxamide |
| SMILES | CN(C(=O)c1cnn(-c2ccc(Cl)cc2)c1C(F)(F)F)C1CCCCC1 |
| InChI | InChI=1S/C18H19ClF3N3O/c1-24(13-5-3-2-4-6-13)17(26)15-11-23-25(16(15)18(20,21)22)14-9-7-12(19)8-10-14/h7-11,13H,2-6H2,1H3 |
| InChIKey | TXOIGTCLNINOIR-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.82 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |