C19H17ClF3N5O — CID 21105002
1-[2-(4-aminophenyl)ethyl]-3-[1-(4-chlorophenyl)-5-(trifluoromethyl)pyrazol-4-yl]urea (PubChem CID 21105002) has the molecular formula C19H17ClF3N5O and a molecular weight of 423.83 g/mol. Its IUPAC name is 1-[2-(4-aminophenyl)ethyl]-3-[1-(4-chlorophenyl)-5-(trifluoromethyl)pyrazol-4-yl]urea.
| Compound Name | 1-[2-(4-aminophenyl)ethyl]-3-[1-(4-chlorophenyl)-5-(trifluoromethyl)pyrazol-4-yl]urea |
|---|---|
| PubChem CID | 21105002 |
| Molecular Formula | C19H17ClF3N5O |
| Molecular Weight | 423.83 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | 1-[2-(4-aminophenyl)ethyl]-3-[1-(4-chlorophenyl)-5-(trifluoromethyl)pyrazol-4-yl]urea |
| SMILES | Nc1ccc(CCNC(=O)Nc2cnn(-c3ccc(Cl)cc3)c2C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H17ClF3N5O/c20-13-3-7-15(8-4-13)28-17(19(21,22)23)16(11-26-28)27-18(29)25-10-9-12-1-5-14(24)6-2-12/h1-8,11H,9-10,24H2,(H2,25,27,29) |
| InChIKey | NRVARGSFRDUKHF-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 84.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.83 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|