C16H16ClF3N4O2 — CID 21104998
1-[1-(4-chlorophenyl)-5-(trifluoromethyl)pyrazol-4-yl]-3-(oxolan-2-ylmethyl)urea (PubChem CID 21104998) has the molecular formula C16H16ClF3N4O2 and a molecular weight of 388.78 g/mol. Its IUPAC name is 1-[1-(4-chlorophenyl)-5-(trifluoromethyl)pyrazol-4-yl]-3-(oxolan-2-ylmethyl)urea.
| Compound Name | 1-[1-(4-chlorophenyl)-5-(trifluoromethyl)pyrazol-4-yl]-3-(oxolan-2-ylmethyl)urea |
|---|---|
| PubChem CID | 21104998 |
| Molecular Formula | C16H16ClF3N4O2 |
| Molecular Weight | 388.78 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | 1-[1-(4-chlorophenyl)-5-(trifluoromethyl)pyrazol-4-yl]-3-(oxolan-2-ylmethyl)urea |
| SMILES | O=C(NCC1CCCO1)Nc1cnn(-c2ccc(Cl)cc2)c1C(F)(F)F |
| InChI | InChI=1S/C16H16ClF3N4O2/c17-10-3-5-11(6-4-10)24-14(16(18,19)20)13(9-22-24)23-15(25)21-8-12-2-1-7-26-12/h3-6,9,12H,1-2,7-8H2,(H2,21,23,25) |
| InChIKey | CMCOJMRPDPFFIV-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.78 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |