C17H18F3N3O3 — CID 42818227
1-(4-methoxyphenyl)-N-(oxolan-2-ylmethyl)-5-(trifluoromethyl)pyrazole-4-carboxamide (PubChem CID 42818227) has the molecular formula C17H18F3N3O3 and a molecular weight of 369.34 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-N-(oxolan-2-ylmethyl)-5-(trifluoromethyl)pyrazole-4-carboxamide.
| Compound Name | 1-(4-methoxyphenyl)-N-(oxolan-2-ylmethyl)-5-(trifluoromethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 42818227 |
| Molecular Formula | C17H18F3N3O3 |
| Molecular Weight | 369.34 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | 1-(4-methoxyphenyl)-N-(oxolan-2-ylmethyl)-5-(trifluoromethyl)pyrazole-4-carboxamide |
| SMILES | COc1ccc(-n2ncc(C(=O)NCC3CCCO3)c2C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H18F3N3O3/c1-25-12-6-4-11(5-7-12)23-15(17(18,19)20)14(10-22-23)16(24)21-9-13-3-2-8-26-13/h4-7,10,13H,2-3,8-9H2,1H3,(H,21,24) |
| InChIKey | YEXPFFCZHPPBFT-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.34 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |