C18H21N3O5 — CID 95099143
6-methoxy-1-(4-methoxyphenyl)-4-oxo-N-[[(2R)-oxolan-2-yl]methyl]pyridazine-3-carboxamide (PubChem CID 95099143) has the molecular formula C18H21N3O5 and a molecular weight of 359.38 g/mol. Its IUPAC name is 6-methoxy-1-(4-methoxyphenyl)-4-oxo-N-[[(2R)-oxolan-2-yl]methyl]pyridazine-3-carboxamide.
| Compound Name | 6-methoxy-1-(4-methoxyphenyl)-4-oxo-N-[[(2R)-oxolan-2-yl]methyl]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 95099143 |
| Molecular Formula | C18H21N3O5 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 6-methoxy-1-(4-methoxyphenyl)-4-oxo-N-[[(2R)-oxolan-2-yl]methyl]pyridazine-3-carboxamide |
| SMILES | COc1ccc(-n2nc(C(=O)NC[C@H]3CCCO3)c(=O)cc2OC)cc1 |
| InChI | InChI=1S/C18H21N3O5/c1-24-13-7-5-12(6-8-13)21-16(25-2)10-15(22)17(20-21)18(23)19-11-14-4-3-9-26-14/h5-8,10,14H,3-4,9,11H2,1-2H3,(H,19,23)/t14-/m1/s1 |
| InChIKey | URVVUUIUZWXAON-CQSZACIVSA-N |
| XLogP | 1.16 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |