C16H18BrN3O2 — CID 46642626
1-(4-bromophenyl)-5-methyl-N-(oxolan-2-ylmethyl)pyrazole-4-carboxamide (PubChem CID 46642626) has the molecular formula C16H18BrN3O2 and a molecular weight of 364.24 g/mol. Its IUPAC name is 1-(4-bromophenyl)-5-methyl-N-(oxolan-2-ylmethyl)pyrazole-4-carboxamide.
| Compound Name | 1-(4-bromophenyl)-5-methyl-N-(oxolan-2-ylmethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 46642626 |
| Molecular Formula | C16H18BrN3O2 |
| Molecular Weight | 364.24 g/mol |
| Exact Mass | 363.06 |
| IUPAC Name | 1-(4-bromophenyl)-5-methyl-N-(oxolan-2-ylmethyl)pyrazole-4-carboxamide |
| SMILES | Cc1c(C(=O)NCC2CCCO2)cnn1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H18BrN3O2/c1-11-15(16(21)18-9-14-3-2-8-22-14)10-19-20(11)13-6-4-12(17)5-7-13/h4-7,10,14H,2-3,8-9H2,1H3,(H,18,21) |
| InChIKey | LJSKDNQYRHYUEY-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.24 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |