C18H14F3N3O — CID 84565038
3-methyl-N-[4-phenyl-5-(trifluoromethyl)-1H-pyrazol-3-yl]benzamide (PubChem CID 84565038) has the molecular formula C18H14F3N3O and a molecular weight of 345.32 g/mol. Its IUPAC name is 3-methyl-N-[4-phenyl-5-(trifluoromethyl)-1H-pyrazol-3-yl]benzamide.
| Compound Name | 3-methyl-N-[4-phenyl-5-(trifluoromethyl)-1H-pyrazol-3-yl]benzamide |
|---|---|
| PubChem CID | 84565038 |
| Molecular Formula | C18H14F3N3O |
| Molecular Weight | 345.32 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 3-methyl-N-[4-phenyl-5-(trifluoromethyl)-1H-pyrazol-3-yl]benzamide |
| SMILES | Cc1cccc(C(=O)Nc2n[nH]c(C(F)(F)F)c2-c2ccccc2)c1 |
| InChI | InChI=1S/C18H14F3N3O/c1-11-6-5-9-13(10-11)17(25)22-16-14(12-7-3-2-4-8-12)15(23-24-16)18(19,20)21/h2-10H,1H3,(H2,22,23,24,25) |
| InChIKey | CNDKIAJKANZUJE-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.32 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |