C22H17F3N2O2 — CID 9172409
2-[(3-methylbenzoyl)amino]-N-[2-(trifluoromethyl)phenyl]benzamide (PubChem CID 9172409) has the molecular formula C22H17F3N2O2 and a molecular weight of 398.38 g/mol. Its IUPAC name is 2-[(3-methylbenzoyl)amino]-N-[2-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 2-[(3-methylbenzoyl)amino]-N-[2-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 9172409 |
| Molecular Formula | C22H17F3N2O2 |
| Molecular Weight | 398.38 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | 2-[(3-methylbenzoyl)amino]-N-[2-(trifluoromethyl)phenyl]benzamide |
| SMILES | Cc1cccc(C(=O)Nc2ccccc2C(=O)Nc2ccccc2C(F)(F)F)c1 |
| InChI | InChI=1S/C22H17F3N2O2/c1-14-7-6-8-15(13-14)20(28)26-18-11-4-2-9-16(18)21(29)27-19-12-5-3-10-17(19)22(23,24)25/h2-13H,1H3,(H,26,28)(H,27,29) |
| InChIKey | KYQOHPPOUQHMJM-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.38 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |