C15H11BrF3NO — CID 103857081
2-bromo-3-methyl-N-[2-(trifluoromethyl)phenyl]benzamide (PubChem CID 103857081) has the molecular formula C15H11BrF3NO and a molecular weight of 358.16 g/mol. Its IUPAC name is 2-bromo-3-methyl-N-[2-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 2-bromo-3-methyl-N-[2-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 103857081 |
| Molecular Formula | C15H11BrF3NO |
| Molecular Weight | 358.16 g/mol |
| Exact Mass | 357.00 |
| IUPAC Name | 2-bromo-3-methyl-N-[2-(trifluoromethyl)phenyl]benzamide |
| SMILES | Cc1cccc(C(=O)Nc2ccccc2C(F)(F)F)c1Br |
| InChI | InChI=1S/C15H11BrF3NO/c1-9-5-4-6-10(13(9)16)14(21)20-12-8-3-2-7-11(12)15(17,18)19/h2-8H,1H3,(H,20,21) |
| InChIKey | YFPAFMPRDFKUOH-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.16 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |