C16H12F3N3O — CID 110701097
2-methyl-N-[2-(trifluoromethyl)phenyl]-1H-benzimidazole-4-carboxamide (PubChem CID 110701097) has the molecular formula C16H12F3N3O and a molecular weight of 319.29 g/mol. Its IUPAC name is 2-methyl-N-[2-(trifluoromethyl)phenyl]-1H-benzimidazole-4-carboxamide.
| Compound Name | 2-methyl-N-[2-(trifluoromethyl)phenyl]-1H-benzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 110701097 |
| Molecular Formula | C16H12F3N3O |
| Molecular Weight | 319.29 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | 2-methyl-N-[2-(trifluoromethyl)phenyl]-1H-benzimidazole-4-carboxamide |
| SMILES | Cc1nc2c(C(=O)Nc3ccccc3C(F)(F)F)cccc2[nH]1 |
| InChI | InChI=1S/C16H12F3N3O/c1-9-20-13-8-4-5-10(14(13)21-9)15(23)22-12-7-3-2-6-11(12)16(17,18)19/h2-8H,1H3,(H,20,21)(H,22,23) |
| InChIKey | FFVFUZVIGWDBTR-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.29 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |