C15H12FN3O — CID 110701119
N-(3-fluorophenyl)-2-methyl-1H-benzimidazole-4-carboxamide (PubChem CID 110701119) has the molecular formula C15H12FN3O and a molecular weight of 269.28 g/mol. Its IUPAC name is N-(3-fluorophenyl)-2-methyl-1H-benzimidazole-4-carboxamide.
| Compound Name | N-(3-fluorophenyl)-2-methyl-1H-benzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 110701119 |
| Molecular Formula | C15H12FN3O |
| Molecular Weight | 269.28 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | N-(3-fluorophenyl)-2-methyl-1H-benzimidazole-4-carboxamide |
| SMILES | Cc1nc2c(C(=O)Nc3cccc(F)c3)cccc2[nH]1 |
| InChI | InChI=1S/C15H12FN3O/c1-9-17-13-7-3-6-12(14(13)18-9)15(20)19-11-5-2-4-10(16)8-11/h2-8H,1H3,(H,17,18)(H,19,20) |
| InChIKey | LWVRSAGCFUNCRW-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.28 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |