C21H18F3N3O3 — CID 84565685
(E)-3-(3,4-dimethoxyphenyl)-N-[4-phenyl-5-(trifluoromethyl)-1H-pyrazol-3-yl]prop-2-enamide (PubChem CID 84565685) has the molecular formula C21H18F3N3O3 and a molecular weight of 417.39 g/mol. Its IUPAC name is (E)-3-(3,4-dimethoxyphenyl)-N-[4-phenyl-5-(trifluoromethyl)-1H-pyrazol-3-yl]prop-2-enamide.
| Compound Name | (E)-3-(3,4-dimethoxyphenyl)-N-[4-phenyl-5-(trifluoromethyl)-1H-pyrazol-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 84565685 |
| Molecular Formula | C21H18F3N3O3 |
| Molecular Weight | 417.39 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | (E)-3-(3,4-dimethoxyphenyl)-N-[4-phenyl-5-(trifluoromethyl)-1H-pyrazol-3-yl]prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)Nc2n[nH]c(C(F)(F)F)c2-c2ccccc2)cc1OC |
| InChI | InChI=1S/C21H18F3N3O3/c1-29-15-10-8-13(12-16(15)30-2)9-11-17(28)25-20-18(14-6-4-3-5-7-14)19(26-27-20)21(22,23)24/h3-12H,1-2H3,(H2,25,26,27,28)/b11-9+ |
| InChIKey | AEDGHGAPFPKYJY-PKNBQFBNSA-N |
| XLogP | 4.76 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.39 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|