C17H12Cl3FN4O — CID 19405820
1-[4-chloro-1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]-3-(3-chlorophenyl)urea (PubChem CID 19405820) has the molecular formula C17H12Cl3FN4O and a molecular weight of 413.67 g/mol. Its IUPAC name is 1-[4-chloro-1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]-3-(3-chlorophenyl)urea.
| Compound Name | 1-[4-chloro-1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]-3-(3-chlorophenyl)urea |
|---|---|
| PubChem CID | 19405820 |
| Molecular Formula | C17H12Cl3FN4O |
| Molecular Weight | 413.67 g/mol |
| Exact Mass | 412.01 |
| IUPAC Name | 1-[4-chloro-1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]-3-(3-chlorophenyl)urea |
| SMILES | O=C(Nc1cccc(Cl)c1)Nc1nn(Cc2c(F)cccc2Cl)cc1Cl |
| InChI | InChI=1S/C17H12Cl3FN4O/c18-10-3-1-4-11(7-10)22-17(26)23-16-14(20)9-25(24-16)8-12-13(19)5-2-6-15(12)21/h1-7,9H,8H2,(H2,22,23,24,26) |
| InChIKey | FFWLFYKXRIFLHM-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.67 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |