C17H13Cl2FN4O — CID 39853155
1-[4-chloro-1-[(2-fluorophenyl)methyl]pyrazol-3-yl]-3-(2-chlorophenyl)urea (PubChem CID 39853155) has the molecular formula C17H13Cl2FN4O and a molecular weight of 379.22 g/mol. Its IUPAC name is 1-[4-chloro-1-[(2-fluorophenyl)methyl]pyrazol-3-yl]-3-(2-chlorophenyl)urea.
| Compound Name | 1-[4-chloro-1-[(2-fluorophenyl)methyl]pyrazol-3-yl]-3-(2-chlorophenyl)urea |
|---|---|
| PubChem CID | 39853155 |
| Molecular Formula | C17H13Cl2FN4O |
| Molecular Weight | 379.22 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | 1-[4-chloro-1-[(2-fluorophenyl)methyl]pyrazol-3-yl]-3-(2-chlorophenyl)urea |
| SMILES | O=C(Nc1ccccc1Cl)Nc1nn(Cc2ccccc2F)cc1Cl |
| InChI | InChI=1S/C17H13Cl2FN4O/c18-12-6-2-4-8-15(12)21-17(25)22-16-13(19)10-24(23-16)9-11-5-1-3-7-14(11)20/h1-8,10H,9H2,(H2,21,22,23,25) |
| InChIKey | KFPPQSXCRMAEIC-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.22 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |