C22H23ClN8O — CID 46891308
1-[3-[6-(3-aminopropylamino)-9-methylpurin-2-yl]phenyl]-3-(3-chlorophenyl)urea (PubChem CID 46891308) has the molecular formula C22H23ClN8O and a molecular weight of 450.93 g/mol. Its IUPAC name is 1-[3-[6-(3-aminopropylamino)-9-methylpurin-2-yl]phenyl]-3-(3-chlorophenyl)urea.
| Compound Name | 1-[3-[6-(3-aminopropylamino)-9-methylpurin-2-yl]phenyl]-3-(3-chlorophenyl)urea |
|---|---|
| PubChem CID | 46891308 |
| Molecular Formula | C22H23ClN8O |
| Molecular Weight | 450.93 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | 1-[3-[6-(3-aminopropylamino)-9-methylpurin-2-yl]phenyl]-3-(3-chlorophenyl)urea |
| SMILES | Cn1cnc2c(NCCCN)nc(-c3cccc(NC(=O)Nc4cccc(Cl)c4)c3)nc21 |
| InChI | InChI=1S/C22H23ClN8O/c1-31-13-26-18-20(25-10-4-9-24)29-19(30-21(18)31)14-5-2-7-16(11-14)27-22(32)28-17-8-3-6-15(23)12-17/h2-3,5-8,11-13H,4,9-10,24H2,1H3,(H,25,29,30)(H2,27,28,32) |
| InChIKey | DNGLOROGIVIBKN-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 122.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.93 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|