C9H14N6 — CID 83833396
N'-(9-methylpurin-6-yl)propane-1,3-diamine (PubChem CID 83833396) has the molecular formula C9H14N6 and a molecular weight of 206.25 g/mol. Its IUPAC name is N'-(9-methylpurin-6-yl)propane-1,3-diamine.
| Compound Name | N'-(9-methylpurin-6-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 83833396 |
| Molecular Formula | C9H14N6 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | N'-(9-methylpurin-6-yl)propane-1,3-diamine |
| SMILES | Cn1cnc2c(NCCCN)ncnc21 |
| InChI | InChI=1S/C9H14N6/c1-15-6-14-7-8(11-4-2-3-10)12-5-13-9(7)15/h5-6H,2-4,10H2,1H3,(H,11,12,13) |
| InChIKey | ZZUDVBWYNGCXFI-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|