C13H15N5O2 — CID 139023673
2-(furan-2-yl)-1-[(9-methylpurin-6-yl)amino]propan-2-ol (PubChem CID 139023673) has the molecular formula C13H15N5O2 and a molecular weight of 273.30 g/mol. Its IUPAC name is 2-(furan-2-yl)-1-[(9-methylpurin-6-yl)amino]propan-2-ol.
| Compound Name | 2-(furan-2-yl)-1-[(9-methylpurin-6-yl)amino]propan-2-ol |
|---|---|
| PubChem CID | 139023673 |
| Molecular Formula | C13H15N5O2 |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | 2-(furan-2-yl)-1-[(9-methylpurin-6-yl)amino]propan-2-ol |
| SMILES | Cn1cnc2c(NCC(C)(O)c3ccco3)ncnc21 |
| InChI | InChI=1S/C13H15N5O2/c1-13(19,9-4-3-5-20-9)6-14-11-10-12(16-7-15-11)18(2)8-17-10/h3-5,7-8,19H,6H2,1-2H3,(H,14,15,16) |
| InChIKey | ZJZANHWGWCIKPB-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 89.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |