C12H14ClN3O3 — CID 133323930
4-chloro-5-[[2-(furan-2-yl)-2-hydroxypropyl]amino]-2-methylpyridazin-3-one (PubChem CID 133323930) has the molecular formula C12H14ClN3O3 and a molecular weight of 283.72 g/mol. Its IUPAC name is 4-chloro-5-[[2-(furan-2-yl)-2-hydroxypropyl]amino]-2-methylpyridazin-3-one.
| Compound Name | 4-chloro-5-[[2-(furan-2-yl)-2-hydroxypropyl]amino]-2-methylpyridazin-3-one |
|---|---|
| PubChem CID | 133323930 |
| Molecular Formula | C12H14ClN3O3 |
| Molecular Weight | 283.72 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | 4-chloro-5-[[2-(furan-2-yl)-2-hydroxypropyl]amino]-2-methylpyridazin-3-one |
| SMILES | Cn1ncc(NCC(C)(O)c2ccco2)c(Cl)c1=O |
| InChI | InChI=1S/C12H14ClN3O3/c1-12(18,9-4-3-5-19-9)7-14-8-6-15-16(2)11(17)10(8)13/h3-6,14,18H,7H2,1-2H3 |
| InChIKey | CHDPHEGLSWVCRE-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 80.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.72 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |