About 4-chloro-2-methyl-5-[(3,3,3-trifluoro-2-hydroxypropyl)amino]pyridazin-3-one
4-chloro-2-methyl-5-[(3,3,3-trifluoro-2-hydroxypropyl)amino]pyridazin-3-one (PubChem CID 113222234) has the molecular formula C8H9ClF3N3O2
and a molecular weight of 271.63 g/mol. Its IUPAC name is 4-chloro-2-methyl-5-[(3,3,3-trifluoro-2-hydroxypropyl)amino]pyridazin-3-one.
Molecular Properties
| Compound Name | 4-chloro-2-methyl-5-[(3,3,3-trifluoro-2-hydroxypropyl)amino]pyridazin-3-one |
| PubChem CID | 113222234 |
| Molecular Formula | C8H9ClF3N3O2 |
| Molecular Weight | 271.63 g/mol |
| Exact Mass | 271.03 |
| IUPAC Name | 4-chloro-2-methyl-5-[(3,3,3-trifluoro-2-hydroxypropyl)amino]pyridazin-3-one |
| SMILES | Cn1ncc(NCC(O)C(F)(F)F)c(Cl)c1=O |
| InChI | InChI=1S/C8H9ClF3N3O2/c1-15-7(17)6(9)4(2-14-15)13-3-5(16)8(10,11)12/h2,5,13,16H,3H2,1H3 |
| InChIKey | UXGLYVLSNDCFGN-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.63 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-chloro-2-methyl-5-[(3,3,3-trifluoro-2-hydroxypropyl)amino]pyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-methyl-5-[(3,3,3-trifluoro-2-hydroxypropyl)amino]pyridazin-3-one?
The IUPAC name of 4-chloro-2-methyl-5-[(3,3,3-trifluoro-2-hydroxypropyl)amino]pyridazin-3-one (CID 113222234) is 4-chloro-2-methyl-5-[(3,3,3-trifluoro-2-hydroxypropyl)amino]pyridazin-3-one.
What is the SMILES notation for 4-chloro-2-methyl-5-[(3,3,3-trifluoro-2-hydroxypropyl)amino]pyridazin-3-one?
The canonical SMILES for 4-chloro-2-methyl-5-[(3,3,3-trifluoro-2-hydroxypropyl)amino]pyridazin-3-one is Cn1ncc(NCC(O)C(F)(F)F)c(Cl)c1=O.
What is the InChIKey of 4-chloro-2-methyl-5-[(3,3,3-trifluoro-2-hydroxypropyl)amino]pyridazin-3-one?
The InChIKey is UXGLYVLSNDCFGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9ClF3N3O2/c1-15-7(17)6(9)4(2-14-15)13-3-5(16)8(10,11)12/h2,5,13,16H,3H2,1H3.
What are the key properties of 4-chloro-2-methyl-5-[(3,3,3-trifluoro-2-hydroxypropyl)amino]pyridazin-3-one?
4-chloro-2-methyl-5-[(3,3,3-trifluoro-2-hydroxypropyl)amino]pyridazin-3-one has a molecular weight of 271.63 g/mol, XLogP of 0.77, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-methyl-5-[(3,3,3-trifluoro-2-hydroxypropyl)amino]pyridazin-3-one is sourced from PubChem (CID 113222234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).